C23H34O3 — CID 135007884
3-[(1E,3E)-5-(oxan-2-yloxy)deca-1,3-dienyl]-4,5,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 135007884) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 3-[(1E,3E)-5-(oxan-2-yloxy)deca-1,3-dienyl]-4,5,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | 3-[(1E,3E)-5-(oxan-2-yloxy)deca-1,3-dienyl]-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 135007884 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 3-[(1E,3E)-5-(oxan-2-yloxy)deca-1,3-dienyl]-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CCCCCC(/C=C/C=C/C1=C2CCCC2CC1=O)OC1CCCCO1 |
| InChI | InChI=1S/C23H34O3/c1-2-3-4-11-19(26-23-15-7-8-16-25-23)12-5-6-13-21-20-14-9-10-18(20)17-22(21)24/h5-6,12-13,18-19,23H,2-4,7-11,14-17H2,1H3/b12-5+,13-6+ |
| InChIKey | JGNHRIPMLZPZHP-BYDSPXIWSA-N |
| XLogP | 5.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|