C27H51ClN4Si2 — CID 135007929
2-benzyl-1,3-ditert-butyl-2-(1,3-ditert-butyl-2-chloro-1,3,2-diazasilolidin-2-yl)-1,3,2-diazasilolidine (PubChem CID 135007929) has the molecular formula C27H51ClN4Si2 and a molecular weight of 523.36 g/mol. Its IUPAC name is 2-benzyl-1,3-ditert-butyl-2-(1,3-ditert-butyl-2-chloro-1,3,2-diazasilolidin-2-yl)-1,3,2-diazasilolidine.
| Compound Name | 2-benzyl-1,3-ditert-butyl-2-(1,3-ditert-butyl-2-chloro-1,3,2-diazasilolidin-2-yl)-1,3,2-diazasilolidine |
|---|---|
| PubChem CID | 135007929 |
| Molecular Formula | C27H51ClN4Si2 |
| Molecular Weight | 523.36 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | 2-benzyl-1,3-ditert-butyl-2-(1,3-ditert-butyl-2-chloro-1,3,2-diazasilolidin-2-yl)-1,3,2-diazasilolidine |
| SMILES | CC(C)(C)N1CCN(C(C)(C)C)[Si]1(Cl)[Si]1(Cc2ccccc2)N(C(C)(C)C)CCN1C(C)(C)C |
| InChI | InChI=1S/C27H51ClN4Si2/c1-24(2,3)29-18-19-30(25(4,5)6)33(29,22-23-16-14-13-15-17-23)34(28)31(26(7,8)9)20-21-32(34)27(10,11)12/h13-17H,18-22H2,1-12H3 |
| InChIKey | USJAPZDWDWSJLB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.36 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|