C29H48O4Si — CID 135007963
methyl (4Z,7Z,10R,11E,13E,15Z,17S,19Z)-17-[tert-butyl(dimethyl)silyl]oxy-10-hydroxydocosa-4,7,11,13,15,19-hexaenoate (PubChem CID 135007963) has the molecular formula C29H48O4Si and a molecular weight of 488.79 g/mol. Its IUPAC name is methyl (4Z,7Z,10R,11E,13E,15Z,17S,19Z)-17-[tert-butyl(dimethyl)silyl]oxy-10-hydroxydocosa-4,7,11,13,15,19-hexaenoate.
| Compound Name | methyl (4Z,7Z,10R,11E,13E,15Z,17S,19Z)-17-[tert-butyl(dimethyl)silyl]oxy-10-hydroxydocosa-4,7,11,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 135007963 |
| Molecular Formula | C29H48O4Si |
| Molecular Weight | 488.79 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | methyl (4Z,7Z,10R,11E,13E,15Z,17S,19Z)-17-[tert-butyl(dimethyl)silyl]oxy-10-hydroxydocosa-4,7,11,13,15,19-hexaenoate |
| SMILES | CC/C=C\C[C@@H](/C=C\C=C\C=C\[C@H](O)C/C=C\C/C=C\CCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H48O4Si/c1-8-9-16-23-27(33-34(6,7)29(2,3)4)24-19-15-14-18-22-26(30)21-17-12-10-11-13-20-25-28(31)32-5/h9,11-19,22,24,26-27,30H,8,10,20-21,23,25H2,1-7H3/b13-11-,15-14+,16-9-,17-12-,22-18+,24-19-/t26-,27+/m1/s1 |
| InChIKey | POOOKSNKLNNYKO-WEEBISEISA-N |
| XLogP | 7.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.79 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|