C15H25NO2SSi — CID 135008008
2-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)ethynyl-trimethylsilane (PubChem CID 135008008) has the molecular formula C15H25NO2SSi and a molecular weight of 311.52 g/mol. Its IUPAC name is 2-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)ethynyl-trimethylsilane.
| Compound Name | 2-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 135008008 |
| Molecular Formula | C15H25NO2SSi |
| Molecular Weight | 311.52 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)ethynyl-trimethylsilane |
| SMILES | CC1(C)C2CCC13CS(=O)(=O)N(C#C[Si](C)(C)C)C3C2 |
| InChI | InChI=1S/C15H25NO2SSi/c1-14(2)12-6-7-15(14)11-19(17,18)16(13(15)10-12)8-9-20(3,4)5/h12-13H,6-7,10-11H2,1-5H3 |
| InChIKey | FFIIOCAZPVKDHY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|