C19H23NO4 — CID 135008022
dimethyl 1-butyl-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 135008022) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is dimethyl 1-butyl-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-butyl-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 135008022 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | dimethyl 1-butyl-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | CCCCN1C=CC(c2ccccc2)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C19H23NO4/c1-4-5-12-20-13-11-15(14-9-7-6-8-10-14)16(18(21)23-2)17(20)19(22)24-3/h6-11,13,15H,4-5,12H2,1-3H3 |
| InChIKey | NBCGNBQEIDRSFV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |