C14H28BClO2Si — CID 135008075
chloro-dimethyl-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-en-2-yl]silane (PubChem CID 135008075) has the molecular formula C14H28BClO2Si and a molecular weight of 302.73 g/mol. Its IUPAC name is chloro-dimethyl-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-en-2-yl]silane.
| Compound Name | chloro-dimethyl-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-en-2-yl]silane |
|---|---|
| PubChem CID | 135008075 |
| Molecular Formula | C14H28BClO2Si |
| Molecular Weight | 302.73 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | chloro-dimethyl-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-1-en-2-yl]silane |
| SMILES | CCCC/C(=C\B1OC(C)(C)C(C)(C)O1)[Si](C)(C)Cl |
| InChI | InChI=1S/C14H28BClO2Si/c1-8-9-10-12(19(6,7)16)11-15-17-13(2,3)14(4,5)18-15/h11H,8-10H2,1-7H3/b12-11+ |
| InChIKey | QDFQIXZHTPJLIP-VAWYXSNFSA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.73 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|