C14H16FNO2 — CID 135008085
methyl (4aS,9aR)-8-fluoro-1,2,3,4,4a,9a-hexahydrocarbazole-9-carboxylate (PubChem CID 135008085) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is methyl (4aS,9aR)-8-fluoro-1,2,3,4,4a,9a-hexahydrocarbazole-9-carboxylate.
| Compound Name | methyl (4aS,9aR)-8-fluoro-1,2,3,4,4a,9a-hexahydrocarbazole-9-carboxylate |
|---|---|
| PubChem CID | 135008085 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | methyl (4aS,9aR)-8-fluoro-1,2,3,4,4a,9a-hexahydrocarbazole-9-carboxylate |
| SMILES | COC(=O)N1c2c(F)cccc2[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C14H16FNO2/c1-18-14(17)16-12-8-3-2-5-9(12)10-6-4-7-11(15)13(10)16/h4,6-7,9,12H,2-3,5,8H2,1H3/t9-,12+/m0/s1 |
| InChIKey | XQMREULWPMLINE-JOYOIKCWSA-N |
| XLogP | 3.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |