C12H15F3O2 — CID 135008238
ethyl (E)-3-cyclohex-2-en-1-yl-4,4,4-trifluorobut-2-enoate (PubChem CID 135008238) has the molecular formula C12H15F3O2 and a molecular weight of 248.24 g/mol. Its IUPAC name is ethyl (E)-3-cyclohex-2-en-1-yl-4,4,4-trifluorobut-2-enoate.
| Compound Name | ethyl (E)-3-cyclohex-2-en-1-yl-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 135008238 |
| Molecular Formula | C12H15F3O2 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | ethyl (E)-3-cyclohex-2-en-1-yl-4,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C=C(\C1C=CCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H15F3O2/c1-2-17-11(16)8-10(12(13,14)15)9-6-4-3-5-7-9/h4,6,8-9H,2-3,5,7H2,1H3/b10-8+ |
| InChIKey | IYIUEPNJAIBRCF-CSKARUKUSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|