About 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane
1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane (PubChem CID 135008280) has the molecular formula C42H39AuNP
and a molecular weight of 785.72 g/mol. Its IUPAC name is 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane.
Molecular Properties
| Compound Name | 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane |
| PubChem CID | 135008280 |
| Molecular Formula | C42H39AuNP |
| Molecular Weight | 785.72 g/mol |
| Exact Mass | 785.25 |
| IUPAC Name | 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane |
| SMILES | [Au+].[CH2-]C1CC(c2ccccc2)(c2ccccc2)CN1Cc1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N.C18H15P.Au/c1-20-17-24(22-13-7-3-8-14-22,23-15-9-4-10-16-23)19-25(20)18-21-11-5-2-6-12-21;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h2-16,20H,1,17-19H2;1-15H;/q-1;;+1 |
| InChIKey | AYEPEXBUKLLHHT-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 785.72 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane?
The IUPAC name of 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane (CID 135008280) is 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane.
What is the SMILES notation for 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane?
The canonical SMILES for 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane is [Au+].[CH2-]C1CC(c2ccccc2)(c2ccccc2)CN1Cc1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane?
The InChIKey is AYEPEXBUKLLHHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N.C18H15P.Au/c1-20-17-24(22-13-7-3-8-14-22,23-15-9-4-10-16-23)19-25(20)18-21-11-5-2-6-12-21;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h2-16,20H,1,17-19H2;1-15H;/q-1;;+1.
What are the key properties of 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane?
1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane has a molecular weight of 785.72 g/mol, XLogP of 8.52, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-methanidyl-4,4-diphenylpyrrolidine;gold(1+);triphenylphosphane is sourced from PubChem (CID 135008280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).