About 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione
2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 135008418) has the molecular formula C9H9IO4
and a molecular weight of 308.07 g/mol. Its IUPAC name is 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| PubChem CID | 135008418 |
| Molecular Formula | C9H9IO4 |
| Molecular Weight | 308.07 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(I)=C(C)C1=O |
| InChI | InChI=1S/C9H9IO4/c1-4-5(10)7(12)9(14-3)8(13-2)6(4)11/h1-3H3 |
| InChIKey | DVGKCEYOVHMZDR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.07 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione?
The IUPAC name of 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (CID 135008418) is 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione?
The canonical SMILES for 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione is COC1=C(OC)C(=O)C(I)=C(C)C1=O.
What is the InChIKey of 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione?
The InChIKey is DVGKCEYOVHMZDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IO4/c1-4-5(10)7(12)9(14-3)8(13-2)6(4)11/h1-3H3.
What are the key properties of 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione?
2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione has a molecular weight of 308.07 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione is sourced from PubChem (CID 135008418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).