C14H27BrOSi — CID 135008495
[(2R,3Z)-4-bromo-2,5-dimethylhexa-3,5-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 135008495) has the molecular formula C14H27BrOSi and a molecular weight of 319.36 g/mol. Its IUPAC name is [(2R,3Z)-4-bromo-2,5-dimethylhexa-3,5-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3Z)-4-bromo-2,5-dimethylhexa-3,5-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135008495 |
| Molecular Formula | C14H27BrOSi |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | [(2R,3Z)-4-bromo-2,5-dimethylhexa-3,5-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | C=C(C)/C(Br)=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27BrOSi/c1-11(2)13(15)9-12(3)10-16-17(7,8)14(4,5)6/h9,12H,1,10H2,2-8H3/b13-9-/t12-/m1/s1 |
| InChIKey | LXQDWCQQWNFMQL-FNWMBBJUSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|