C22H44O2Si2 — CID 135008502
tert-butyl-[4-[4-[tert-butyl(dimethyl)silyl]oxybut-1-ynyl]cyclohexyl]oxy-dimethylsilane (PubChem CID 135008502) has the molecular formula C22H44O2Si2 and a molecular weight of 396.76 g/mol. Its IUPAC name is tert-butyl-[4-[4-[tert-butyl(dimethyl)silyl]oxybut-1-ynyl]cyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[4-[4-[tert-butyl(dimethyl)silyl]oxybut-1-ynyl]cyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135008502 |
| Molecular Formula | C22H44O2Si2 |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | tert-butyl-[4-[4-[tert-butyl(dimethyl)silyl]oxybut-1-ynyl]cyclohexyl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC#CC1CCC(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C22H44O2Si2/c1-21(2,3)25(7,8)23-18-12-11-13-19-14-16-20(17-15-19)24-26(9,10)22(4,5)6/h19-20H,12,14-18H2,1-10H3 |
| InChIKey | HKYUZFDNNROLGD-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|