C16H19F3N2O2 — CID 135008813
tert-butyl 4-[2-amino-4-(trifluoromethyl)phenyl]-2,3-dihydropyrrole-1-carboxylate (PubChem CID 135008813) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is tert-butyl 4-[2-amino-4-(trifluoromethyl)phenyl]-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 4-[2-amino-4-(trifluoromethyl)phenyl]-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 135008813 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | tert-butyl 4-[2-amino-4-(trifluoromethyl)phenyl]-2,3-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=C(c2ccc(C(F)(F)F)cc2N)CC1 |
| InChI | InChI=1S/C16H19F3N2O2/c1-15(2,3)23-14(22)21-7-6-10(9-21)12-5-4-11(8-13(12)20)16(17,18)19/h4-5,8-9H,6-7,20H2,1-3H3 |
| InChIKey | WBMJZUAMFZAQLB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|