C26H45IN4Si2 — CID 135008832
1,3-ditert-butyl-2-(1,3-ditert-butyl-2-iodo-1,3,2-diazasilol-2-yl)-2-phenyl-1,3,2-diazasilole (PubChem CID 135008832) has the molecular formula C26H45IN4Si2 and a molecular weight of 596.75 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-(1,3-ditert-butyl-2-iodo-1,3,2-diazasilol-2-yl)-2-phenyl-1,3,2-diazasilole.
| Compound Name | 1,3-ditert-butyl-2-(1,3-ditert-butyl-2-iodo-1,3,2-diazasilol-2-yl)-2-phenyl-1,3,2-diazasilole |
|---|---|
| PubChem CID | 135008832 |
| Molecular Formula | C26H45IN4Si2 |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 1,3-ditert-butyl-2-(1,3-ditert-butyl-2-iodo-1,3,2-diazasilol-2-yl)-2-phenyl-1,3,2-diazasilole |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)[Si]1(I)[Si]1(c2ccccc2)N(C(C)(C)C)C=CN1C(C)(C)C |
| InChI | InChI=1S/C26H45IN4Si2/c1-23(2,3)28-18-19-29(24(4,5)6)32(28,22-16-14-13-15-17-22)33(27)30(25(7,8)9)20-21-31(33)26(10,11)12/h13-21H,1-12H3 |
| InChIKey | WIBOWUSGRVEGNS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|