C18H35BO2 — CID 135008850
2-[(Z)-2,2-dimethyldec-3-en-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 135008850) has the molecular formula C18H35BO2 and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-[(Z)-2,2-dimethyldec-3-en-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(Z)-2,2-dimethyldec-3-en-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 135008850 |
| Molecular Formula | C18H35BO2 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 2-[(Z)-2,2-dimethyldec-3-en-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCC/C(=C\C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H35BO2/c1-9-10-11-12-13-15(14-16(2,3)4)19-20-17(5,6)18(7,8)21-19/h14H,9-13H2,1-8H3/b15-14+ |
| InChIKey | ZPRXMZDSURLBQE-CCEZHUSRSA-N |
| XLogP | 5.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|