C17H23NO3 — CID 135009013
(3R,5R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-ethenyl-1,2-oxazolidine (PubChem CID 135009013) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is (3R,5R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-ethenyl-1,2-oxazolidine.
| Compound Name | (3R,5R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-ethenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 135009013 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (3R,5R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-ethenyl-1,2-oxazolidine |
| SMILES | C=C[C@H]1C[C@H]([C@H]2COC(C)(C)O2)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C17H23NO3/c1-4-14-10-15(16-12-19-17(2,3)20-16)18(21-14)11-13-8-6-5-7-9-13/h4-9,14-16H,1,10-12H2,2-3H3/t14-,15+,16+/m0/s1 |
| InChIKey | SJIYZNUPGBDHSR-ARFHVFGLSA-N |
| XLogP | 2.90 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|