C45H46O8SSi — CID 135009031
[(3R,6S)-4,5-dibenzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethylsulfanyloxan-3-yl] benzoate (PubChem CID 135009031) has the molecular formula C45H46O8SSi and a molecular weight of 775.01 g/mol. Its IUPAC name is [(3R,6S)-4,5-dibenzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethylsulfanyloxan-3-yl] benzoate.
| Compound Name | [(3R,6S)-4,5-dibenzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethylsulfanyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 135009031 |
| Molecular Formula | C45H46O8SSi |
| Molecular Weight | 775.01 g/mol |
| Exact Mass | 774.27 |
| IUPAC Name | [(3R,6S)-4,5-dibenzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethylsulfanyloxan-3-yl] benzoate |
| SMILES | CCS[C@@H]1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C45H46O8SSi/c1-5-54-44-40(53-43(48)34-25-15-8-16-26-34)39(52-42(47)33-23-13-7-14-24-33)38(51-41(46)32-21-11-6-12-22-32)37(50-44)31-49-55(45(2,3)4,35-27-17-9-18-28-35)36-29-19-10-20-30-36/h6-30,37-40,44H,5,31H2,1-4H3/t37?,38-,39?,40?,44+/m1/s1 |
| InChIKey | WOXDTLAEUVMQHD-FVUHSAGZSA-N |
| XLogP | 7.72 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.01 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|