C25H46O3Si — CID 135009086
[(1R,6S)-4,6-dimethylcyclohex-3-en-1-yl] (5S)-6,8-dimethyl-5-triethylsilyloxynon-8-enoate (PubChem CID 135009086) has the molecular formula C25H46O3Si and a molecular weight of 422.73 g/mol. Its IUPAC name is [(1R,6S)-4,6-dimethylcyclohex-3-en-1-yl] (5S)-6,8-dimethyl-5-triethylsilyloxynon-8-enoate.
| Compound Name | [(1R,6S)-4,6-dimethylcyclohex-3-en-1-yl] (5S)-6,8-dimethyl-5-triethylsilyloxynon-8-enoate |
|---|---|
| PubChem CID | 135009086 |
| Molecular Formula | C25H46O3Si |
| Molecular Weight | 422.73 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | [(1R,6S)-4,6-dimethylcyclohex-3-en-1-yl] (5S)-6,8-dimethyl-5-triethylsilyloxynon-8-enoate |
| SMILES | C=C(C)CC(C)[C@H](CCCC(=O)O[C@@H]1CC=C(C)C[C@@H]1C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H46O3Si/c1-9-29(10-2,11-3)28-24(21(7)17-19(4)5)13-12-14-25(26)27-23-16-15-20(6)18-22(23)8/h15,21-24H,4,9-14,16-18H2,1-3,5-8H3/t21?,22-,23+,24-/m0/s1 |
| InChIKey | YRDUVCAIBQZLQL-NHYNNZIHSA-N |
| XLogP | 7.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.73 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|