C17H22N2O — CID 135009159
4,4-dimethyl-1,15-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),11,13-trien-6-one (PubChem CID 135009159) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 4,4-dimethyl-1,15-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),11,13-trien-6-one.
| Compound Name | 4,4-dimethyl-1,15-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),11,13-trien-6-one |
|---|---|
| PubChem CID | 135009159 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 4,4-dimethyl-1,15-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),11,13-trien-6-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)N1CCn3cccc3C1CC2 |
| InChI | InChI=1S/C17H22N2O/c1-17(2)10-15-12(16(20)11-17)5-6-14-13-4-3-7-18(13)8-9-19(14)15/h3-4,7,14H,5-6,8-11H2,1-2H3 |
| InChIKey | SBANICLVRFRARK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |