C12H19O3+ — CID 135009186
ethyl (1S,3aR,6aS)-6a-hydroxy-1-methyl-1,2,3,4,5,6-hexahydropentalen-5-ylium-3a-carboxylate (PubChem CID 135009186) has the molecular formula C12H19O3+ and a molecular weight of 211.28 g/mol. Its IUPAC name is ethyl (1S,3aR,6aS)-6a-hydroxy-1-methyl-1,2,3,4,5,6-hexahydropentalen-5-ylium-3a-carboxylate.
| Compound Name | ethyl (1S,3aR,6aS)-6a-hydroxy-1-methyl-1,2,3,4,5,6-hexahydropentalen-5-ylium-3a-carboxylate |
|---|---|
| PubChem CID | 135009186 |
| Molecular Formula | C12H19O3+ |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | ethyl (1S,3aR,6aS)-6a-hydroxy-1-methyl-1,2,3,4,5,6-hexahydropentalen-5-ylium-3a-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[CH+]C[C@]1(O)[C@@H](C)CC2 |
| InChI | InChI=1S/C12H19O3/c1-3-15-10(13)11-6-4-7-12(11,14)9(2)5-8-11/h4,9,14H,3,5-8H2,1-2H3/q+1/t9-,11-,12-/m0/s1 |
| InChIKey | USQOQSNSSBWWNH-DLOVCJGASA-N |
| XLogP | 1.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|