C22H29NO — CID 135009225
5-methyl-1-(6-methyl-2-pyridinyl)-2-(2-phenylpropan-2-yl)cyclohexan-1-ol (PubChem CID 135009225) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 5-methyl-1-(6-methyl-2-pyridinyl)-2-(2-phenylpropan-2-yl)cyclohexan-1-ol.
| Compound Name | 5-methyl-1-(6-methyl-2-pyridinyl)-2-(2-phenylpropan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 135009225 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 5-methyl-1-(6-methyl-2-pyridinyl)-2-(2-phenylpropan-2-yl)cyclohexan-1-ol |
| SMILES | Cc1cccc(C2(O)CC(C)CCC2C(C)(C)c2ccccc2)n1 |
| InChI | InChI=1S/C22H29NO/c1-16-13-14-19(21(3,4)18-10-6-5-7-11-18)22(24,15-16)20-12-8-9-17(2)23-20/h5-12,16,19,24H,13-15H2,1-4H3 |
| InChIKey | MHHNVPKSCCYHTQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |