C19H24O2S2 — CID 135009260
(3E,5E)-7-[2-[2-(4-hydroxyphenyl)ethyl]-1,3-dithian-2-yl]hepta-3,5-dien-2-one (PubChem CID 135009260) has the molecular formula C19H24O2S2 and a molecular weight of 348.53 g/mol. Its IUPAC name is (3E,5E)-7-[2-[2-(4-hydroxyphenyl)ethyl]-1,3-dithian-2-yl]hepta-3,5-dien-2-one.
| Compound Name | (3E,5E)-7-[2-[2-(4-hydroxyphenyl)ethyl]-1,3-dithian-2-yl]hepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 135009260 |
| Molecular Formula | C19H24O2S2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (3E,5E)-7-[2-[2-(4-hydroxyphenyl)ethyl]-1,3-dithian-2-yl]hepta-3,5-dien-2-one |
| SMILES | CC(=O)/C=C/C=C/CC1(CCc2ccc(O)cc2)SCCCS1 |
| InChI | InChI=1S/C19H24O2S2/c1-16(20)6-3-2-4-12-19(22-14-5-15-23-19)13-11-17-7-9-18(21)10-8-17/h2-4,6-10,21H,5,11-15H2,1H3/b4-2+,6-3+ |
| InChIKey | RKGCBPVNHBVKAS-PIXFVPMGSA-N |
| XLogP | 4.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|