C36H35NO5 — CID 135009266
(3S,4S,5S,6R)-3-isocyanato-4,5,6-tris(phenylmethoxy)-1-(phenylmethoxymethyl)cyclohexene (PubChem CID 135009266) has the molecular formula C36H35NO5 and a molecular weight of 561.68 g/mol. Its IUPAC name is (3S,4S,5S,6R)-3-isocyanato-4,5,6-tris(phenylmethoxy)-1-(phenylmethoxymethyl)cyclohexene.
| Compound Name | (3S,4S,5S,6R)-3-isocyanato-4,5,6-tris(phenylmethoxy)-1-(phenylmethoxymethyl)cyclohexene |
|---|---|
| PubChem CID | 135009266 |
| Molecular Formula | C36H35NO5 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | (3S,4S,5S,6R)-3-isocyanato-4,5,6-tris(phenylmethoxy)-1-(phenylmethoxymethyl)cyclohexene |
| SMILES | O=C=N[C@H]1C=C(COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H35NO5/c38-27-37-33-21-32(26-39-22-28-13-5-1-6-14-28)34(40-23-29-15-7-2-8-16-29)36(42-25-31-19-11-4-12-20-31)35(33)41-24-30-17-9-3-10-18-30/h1-21,33-36H,22-26H2/t33-,34+,35-,36-/m0/s1 |
| InChIKey | PONXSVZKDUUBPY-WLPVSNDTSA-N |
| XLogP | 6.60 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|