C18H29NO — CID 135009280
(5E)-13-hydroxy-6,10,14-trimethylpentadeca-5,9,14-trienenitrile (PubChem CID 135009280) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is (5E)-13-hydroxy-6,10,14-trimethylpentadeca-5,9,14-trienenitrile.
| Compound Name | (5E)-13-hydroxy-6,10,14-trimethylpentadeca-5,9,14-trienenitrile |
|---|---|
| PubChem CID | 135009280 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | (5E)-13-hydroxy-6,10,14-trimethylpentadeca-5,9,14-trienenitrile |
| SMILES | C=C(C)C(O)CCC(C)=CCC/C(C)=C/CCCC#N |
| InChI | InChI=1S/C18H29NO/c1-15(2)18(20)13-12-17(4)11-8-10-16(3)9-6-5-7-14-19/h9,11,18,20H,1,5-8,10,12-13H2,2-4H3/b16-9+,17-11? |
| InChIKey | BFSGGWXFWAFXSN-GCLDPNIWSA-N |
| XLogP | 5.07 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|