C11H18 — CID 135009382
(1S,5S)-2,3,6,6-tetramethylbicyclo[3.1.1]hept-2-ene (PubChem CID 135009382) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (1S,5S)-2,3,6,6-tetramethylbicyclo[3.1.1]hept-2-ene.
| Compound Name | (1S,5S)-2,3,6,6-tetramethylbicyclo[3.1.1]hept-2-ene |
|---|---|
| PubChem CID | 135009382 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (1S,5S)-2,3,6,6-tetramethylbicyclo[3.1.1]hept-2-ene |
| SMILES | CC1=C(C)[C@H]2C[C@@H](C1)C2(C)C |
| InChI | InChI=1S/C11H18/c1-7-5-9-6-10(8(7)2)11(9,3)4/h9-10H,5-6H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | XTWQWXADGVBZDQ-NXEZZACHSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|