C16H28O6 — CID 135009666
[(1R,2R,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-propan-2-yloxyhex-5-enyl] acetate (PubChem CID 135009666) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is [(1R,2R,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-propan-2-yloxyhex-5-enyl] acetate.
| Compound Name | [(1R,2R,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-propan-2-yloxyhex-5-enyl] acetate |
|---|---|
| PubChem CID | 135009666 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | [(1R,2R,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-propan-2-yloxyhex-5-enyl] acetate |
| SMILES | C=CC[C@H](O)[C@@H](OC(C)C)[C@H](OC(C)=O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H28O6/c1-7-8-12(18)14(20-10(2)3)15(21-11(4)17)13-9-19-16(5,6)22-13/h7,10,12-15,18H,1,8-9H2,2-6H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | NKARQXSDTXGPEI-GBJTYRQASA-N |
| XLogP | 1.80 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|