C21H33NO3Si — CID 135009702
tert-butyl (3R,6S)-3,5-dimethyl-6-phenyl-4-(trimethylsilylmethyl)-3,6-dihydrooxazine-2-carboxylate (PubChem CID 135009702) has the molecular formula C21H33NO3Si and a molecular weight of 375.59 g/mol. Its IUPAC name is tert-butyl (3R,6S)-3,5-dimethyl-6-phenyl-4-(trimethylsilylmethyl)-3,6-dihydrooxazine-2-carboxylate.
| Compound Name | tert-butyl (3R,6S)-3,5-dimethyl-6-phenyl-4-(trimethylsilylmethyl)-3,6-dihydrooxazine-2-carboxylate |
|---|---|
| PubChem CID | 135009702 |
| Molecular Formula | C21H33NO3Si |
| Molecular Weight | 375.59 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | tert-butyl (3R,6S)-3,5-dimethyl-6-phenyl-4-(trimethylsilylmethyl)-3,6-dihydrooxazine-2-carboxylate |
| SMILES | CC1=C(C[Si](C)(C)C)[C@@H](C)N(C(=O)OC(C)(C)C)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H33NO3Si/c1-15-18(14-26(6,7)8)16(2)22(20(23)24-21(3,4)5)25-19(15)17-12-10-9-11-13-17/h9-13,16,19H,14H2,1-8H3/t16-,19-/m1/s1 |
| InChIKey | WODQMCXLQANUIU-VQIMIIECSA-N |
| XLogP | 5.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|