C18H24FNO3 — CID 135009703
tert-butyl (3R,5S,6S)-5-fluoro-3,5-dimethyl-4-methylidene-6-phenyloxazinane-2-carboxylate (PubChem CID 135009703) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is tert-butyl (3R,5S,6S)-5-fluoro-3,5-dimethyl-4-methylidene-6-phenyloxazinane-2-carboxylate.
| Compound Name | tert-butyl (3R,5S,6S)-5-fluoro-3,5-dimethyl-4-methylidene-6-phenyloxazinane-2-carboxylate |
|---|---|
| PubChem CID | 135009703 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | tert-butyl (3R,5S,6S)-5-fluoro-3,5-dimethyl-4-methylidene-6-phenyloxazinane-2-carboxylate |
| SMILES | C=C1[C@@H](C)N(C(=O)OC(C)(C)C)O[C@@H](c2ccccc2)[C@@]1(C)F |
| InChI | InChI=1S/C18H24FNO3/c1-12-13(2)20(16(21)22-17(3,4)5)23-15(18(12,6)19)14-10-8-7-9-11-14/h7-11,13,15H,1H2,2-6H3/t13-,15+,18+/m1/s1 |
| InChIKey | WKNLUSFDZZYORO-XUWXXGDYSA-N |
| XLogP | 4.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|