C21H22FNO3 — CID 135009705
benzyl (3R,5S,6S)-5-fluoro-3,5-dimethyl-4-methylidene-6-phenyloxazinane-2-carboxylate (PubChem CID 135009705) has the molecular formula C21H22FNO3 and a molecular weight of 355.41 g/mol. Its IUPAC name is benzyl (3R,5S,6S)-5-fluoro-3,5-dimethyl-4-methylidene-6-phenyloxazinane-2-carboxylate.
| Compound Name | benzyl (3R,5S,6S)-5-fluoro-3,5-dimethyl-4-methylidene-6-phenyloxazinane-2-carboxylate |
|---|---|
| PubChem CID | 135009705 |
| Molecular Formula | C21H22FNO3 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | benzyl (3R,5S,6S)-5-fluoro-3,5-dimethyl-4-methylidene-6-phenyloxazinane-2-carboxylate |
| SMILES | C=C1[C@@H](C)N(C(=O)OCc2ccccc2)O[C@@H](c2ccccc2)[C@@]1(C)F |
| InChI | InChI=1S/C21H22FNO3/c1-15-16(2)23(20(24)25-14-17-10-6-4-7-11-17)26-19(21(15,3)22)18-12-8-5-9-13-18/h4-13,16,19H,1,14H2,2-3H3/t16-,19+,21+/m1/s1 |
| InChIKey | NTJDJKMPPIQJCM-PBEJRMEISA-N |
| XLogP | 4.98 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|