C22H22FNO2 — CID 135009707
(E)-1-[(3R,5R,6S)-5-fluoro-3,5-dimethyl-4-methylidene-6-phenyloxazinan-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 135009707) has the molecular formula C22H22FNO2 and a molecular weight of 351.42 g/mol. Its IUPAC name is (E)-1-[(3R,5R,6S)-5-fluoro-3,5-dimethyl-4-methylidene-6-phenyloxazinan-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(3R,5R,6S)-5-fluoro-3,5-dimethyl-4-methylidene-6-phenyloxazinan-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 135009707 |
| Molecular Formula | C22H22FNO2 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (E)-1-[(3R,5R,6S)-5-fluoro-3,5-dimethyl-4-methylidene-6-phenyloxazinan-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | C=C1[C@@H](C)N(C(=O)/C=C/c2ccccc2)O[C@@H](c2ccccc2)[C@]1(C)F |
| InChI | InChI=1S/C22H22FNO2/c1-16-17(2)24(20(25)15-14-18-10-6-4-7-11-18)26-21(22(16,3)23)19-12-8-5-9-13-19/h4-15,17,21H,1H2,2-3H3/b15-14+/t17-,21+,22-/m1/s1 |
| InChIKey | ZEBZFABDPFXCTD-AJLVJRAFSA-N |
| XLogP | 4.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|