C20H20FNO3 — CID 135009753
benzyl (3R,5S,6S)-5-fluoro-3-methyl-4-methylidene-6-phenyloxazinane-2-carboxylate (PubChem CID 135009753) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is benzyl (3R,5S,6S)-5-fluoro-3-methyl-4-methylidene-6-phenyloxazinane-2-carboxylate.
| Compound Name | benzyl (3R,5S,6S)-5-fluoro-3-methyl-4-methylidene-6-phenyloxazinane-2-carboxylate |
|---|---|
| PubChem CID | 135009753 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | benzyl (3R,5S,6S)-5-fluoro-3-methyl-4-methylidene-6-phenyloxazinane-2-carboxylate |
| SMILES | C=C1[C@@H](C)N(C(=O)OCc2ccccc2)O[C@@H](c2ccccc2)[C@H]1F |
| InChI | InChI=1S/C20H20FNO3/c1-14-15(2)22(20(23)24-13-16-9-5-3-6-10-16)25-19(18(14)21)17-11-7-4-8-12-17/h3-12,15,18-19H,1,13H2,2H3/t15-,18+,19+/m1/s1 |
| InChIKey | VOCOPHHVUIWBTO-MNEFBYGVSA-N |
| XLogP | 4.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|