C15H14F3NO4 — CID 135009765
ethyl 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]-2-oxoacetate (PubChem CID 135009765) has the molecular formula C15H14F3NO4 and a molecular weight of 329.27 g/mol. Its IUPAC name is ethyl 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 135009765 |
| Molecular Formula | C15H14F3NO4 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | ethyl 2-[benzyl-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N(/C=C/C(=O)C(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C15H14F3NO4/c1-2-23-14(22)13(21)19(9-8-12(20)15(16,17)18)10-11-6-4-3-5-7-11/h3-9H,2,10H2,1H3/b9-8+ |
| InChIKey | LIRSYPKCXVYPEE-CMDGGOBGSA-N |
| XLogP | 2.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|