C11H20O5 — CID 135009767
(2R,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-propan-2-yloxypropanal (PubChem CID 135009767) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2R,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-propan-2-yloxypropanal.
| Compound Name | (2R,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-propan-2-yloxypropanal |
|---|---|
| PubChem CID | 135009767 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2R,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-propan-2-yloxypropanal |
| SMILES | CC(C)O[C@@H](C=O)[C@@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H20O5/c1-7(2)15-8(5-12)10(13)9-6-14-11(3,4)16-9/h5,7-10,13H,6H2,1-4H3/t8-,9+,10+/m0/s1 |
| InChIKey | LXQQSMZJPJLLBX-IVZWLZJFSA-N |
| XLogP | 0.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|