About CID 135009788
CID 135009788 (PubChem CID 135009788) has the molecular formula C28H42O10
and a molecular weight of 538.63 g/mol.
Molecular Properties
| Compound Name | CID 135009788 |
| PubChem CID | 135009788 |
| Molecular Formula | C28H42O10 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | — |
| SMILES | CC(=O)OC[C@@]12[C@@H](OCOC(C)C)C[C@]3(C)O[C@@]4(COC(=O)C4)C[C@H](OC(C)=O)[C@]3(C)[C@H]1CCC[C@]21CO1 |
| InChI | InChI=1S/C28H42O10/c1-17(2)34-16-35-22-10-24(5)25(6,21(37-19(4)30)11-26(38-24)12-23(31)33-13-26)20-8-7-9-27(14-36-27)28(20,22)15-32-18(3)29/h17,20-22H,7-16H2,1-6H3/t20-,21+,22+,24+,25+,26+,27+,28+/m1/s1 |
| InChIKey | AGQFULMACRCPCI-KSAJOIIGSA-N |
| XLogP | 3.08 |
| TPSA | 119.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 135009788 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135009788?
The IUPAC name of CID 135009788 (CID 135009788) is not available.
What is the SMILES notation for CID 135009788?
The canonical SMILES for CID 135009788 is CC(=O)OC[C@@]12[C@@H](OCOC(C)C)C[C@]3(C)O[C@@]4(COC(=O)C4)C[C@H](OC(C)=O)[C@]3(C)[C@H]1CCC[C@]21CO1.
What is the InChIKey of CID 135009788?
The InChIKey is AGQFULMACRCPCI-KSAJOIIGSA-N. The full InChI is InChI=1S/C28H42O10/c1-17(2)34-16-35-22-10-24(5)25(6,21(37-19(4)30)11-26(38-24)12-23(31)33-13-26)20-8-7-9-27(14-36-27)28(20,22)15-32-18(3)29/h17,20-22H,7-16H2,1-6H3/t20-,21+,22+,24+,25+,26+,27+,28+/m1/s1.
What are the key properties of CID 135009788?
CID 135009788 has a molecular weight of 538.63 g/mol, XLogP of 3.08, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135009788 is sourced from PubChem (CID 135009788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).