C17H21NO4 — CID 135009810
ethyl 2-butyl-6-oxo-3-phenyl-2H-1,3-oxazine-4-carboxylate (PubChem CID 135009810) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl 2-butyl-6-oxo-3-phenyl-2H-1,3-oxazine-4-carboxylate.
| Compound Name | ethyl 2-butyl-6-oxo-3-phenyl-2H-1,3-oxazine-4-carboxylate |
|---|---|
| PubChem CID | 135009810 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | ethyl 2-butyl-6-oxo-3-phenyl-2H-1,3-oxazine-4-carboxylate |
| SMILES | CCCCC1OC(=O)C=C(C(=O)OCC)N1c1ccccc1 |
| InChI | InChI=1S/C17H21NO4/c1-3-5-11-15-18(13-9-7-6-8-10-13)14(12-16(19)22-15)17(20)21-4-2/h6-10,12,15H,3-5,11H2,1-2H3 |
| InChIKey | XOGHTJBVBXSULT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |