C29H40O4 — CID 135009995
(4S,6R,7S)-7-[(1E,3E,5Z,7Z,9E,11R,12E)-11-hydroxy-2,4,6,8,10,12-hexamethyltetradeca-1,3,5,7,9,12-hexaenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione (PubChem CID 135009995) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is (4S,6R,7S)-7-[(1E,3E,5Z,7Z,9E,11R,12E)-11-hydroxy-2,4,6,8,10,12-hexamethyltetradeca-1,3,5,7,9,12-hexaenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione.
| Compound Name | (4S,6R,7S)-7-[(1E,3E,5Z,7Z,9E,11R,12E)-11-hydroxy-2,4,6,8,10,12-hexamethyltetradeca-1,3,5,7,9,12-hexaenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione |
|---|---|
| PubChem CID | 135009995 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | (4S,6R,7S)-7-[(1E,3E,5Z,7Z,9E,11R,12E)-11-hydroxy-2,4,6,8,10,12-hexamethyltetradeca-1,3,5,7,9,12-hexaenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione |
| SMILES | C/C=C(\C)[C@@H](O)/C(C)=C/C(C)=C\C(C)=C/C(C)=C/C(C)=C/[C@]1(C)C2OC(=O)[C@]1(C)C(=O)[C@@H]2C |
| InChI | InChI=1S/C29H40O4/c1-11-21(6)24(30)22(7)15-19(4)13-17(2)12-18(3)14-20(5)16-28(9)26-23(8)25(31)29(28,10)27(32)33-26/h11-16,23-24,26,30H,1-10H3/b17-12-,18-14+,19-13-,20-16+,21-11+,22-15+/t23-,24+,26?,28+,29-/m0/s1 |
| InChIKey | XCBSGBRMOLLTTQ-OKHPZCDQSA-N |
| XLogP | 6.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|