C35H58O7Si2 — CID 135010041
(3R,4S,5R,7R)-8-[tert-butyl(diphenyl)silyl]oxy-3,4-bis(methoxymethoxy)-5-methyl-7-triethylsilyloxyoctan-2-one (PubChem CID 135010041) has the molecular formula C35H58O7Si2 and a molecular weight of 647.01 g/mol. Its IUPAC name is (3R,4S,5R,7R)-8-[tert-butyl(diphenyl)silyl]oxy-3,4-bis(methoxymethoxy)-5-methyl-7-triethylsilyloxyoctan-2-one.
| Compound Name | (3R,4S,5R,7R)-8-[tert-butyl(diphenyl)silyl]oxy-3,4-bis(methoxymethoxy)-5-methyl-7-triethylsilyloxyoctan-2-one |
|---|---|
| PubChem CID | 135010041 |
| Molecular Formula | C35H58O7Si2 |
| Molecular Weight | 647.01 g/mol |
| Exact Mass | 646.37 |
| IUPAC Name | (3R,4S,5R,7R)-8-[tert-butyl(diphenyl)silyl]oxy-3,4-bis(methoxymethoxy)-5-methyl-7-triethylsilyloxyoctan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@H](C)[C@H](OCOC)[C@@H](OCOC)C(C)=O |
| InChI | InChI=1S/C35H58O7Si2/c1-11-43(12-2,13-3)42-30(24-28(4)33(39-26-37-9)34(29(5)36)40-27-38-10)25-41-44(35(6,7)8,31-20-16-14-17-21-31)32-22-18-15-19-23-32/h14-23,28,30,33-34H,11-13,24-27H2,1-10H3/t28-,30-,33+,34+/m1/s1 |
| InChIKey | TXYYEFDZOQZCFW-ORDUSYSVSA-N |
| XLogP | 6.55 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.01 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|