C11H18F3NO2 — CID 135010069
N-(4,4-dimethyl-5-oxoheptyl)-2,2,2-trifluoroacetamide (PubChem CID 135010069) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is N-(4,4-dimethyl-5-oxoheptyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4,4-dimethyl-5-oxoheptyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 135010069 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(4,4-dimethyl-5-oxoheptyl)-2,2,2-trifluoroacetamide |
| SMILES | CCC(=O)C(C)(C)CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H18F3NO2/c1-4-8(16)10(2,3)6-5-7-15-9(17)11(12,13)14/h4-7H2,1-3H3,(H,15,17) |
| InChIKey | AANZSUMHPMUPPW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|