C20H24N6O4 — CID 135010095
(2R,3R,4S,5R)-2,3-diazido-4,6-bis(phenylmethoxy)hexane-1,5-diol (PubChem CID 135010095) has the molecular formula C20H24N6O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2,3-diazido-4,6-bis(phenylmethoxy)hexane-1,5-diol.
| Compound Name | (2R,3R,4S,5R)-2,3-diazido-4,6-bis(phenylmethoxy)hexane-1,5-diol |
|---|---|
| PubChem CID | 135010095 |
| Molecular Formula | C20H24N6O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (2R,3R,4S,5R)-2,3-diazido-4,6-bis(phenylmethoxy)hexane-1,5-diol |
| SMILES | [N-]=[N+]=N[C@@H]([C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1)[C@H](CO)N=[N+]=[N-] |
| InChI | InChI=1S/C20H24N6O4/c21-25-23-17(11-27)19(24-26-22)20(30-13-16-9-5-2-6-10-16)18(28)14-29-12-15-7-3-1-4-8-15/h1-10,17-20,27-28H,11-14H2/t17-,18+,19+,20+/m0/s1 |
| InChIKey | ACCZTSKHTSLEGO-MTQWCTHYSA-N |
| XLogP | 3.50 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|