About [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate
[(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate (PubChem CID 135010101) has the molecular formula C19H21BrO5
and a molecular weight of 409.28 g/mol. Its IUPAC name is [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate.
Molecular Properties
| Compound Name | [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate |
| PubChem CID | 135010101 |
| Molecular Formula | C19H21BrO5 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate |
| SMILES | COC(=O)/C=C/CC[C@@]1(C)C(=O)CC[C@@H]1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H21BrO5/c1-19(12-4-3-5-17(22)24-2)15(21)10-11-16(19)25-18(23)13-6-8-14(20)9-7-13/h3,5-9,16H,4,10-12H2,1-2H3/b5-3+/t16-,19-/m0/s1 |
| InChIKey | YZPPBZZKLKOWCM-JLCHBGMNSA-N |
| XLogP | 3.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate?
The IUPAC name of [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate (CID 135010101) is [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate.
What is the SMILES notation for [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate?
The canonical SMILES for [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate is COC(=O)/C=C/CC[C@@]1(C)C(=O)CC[C@@H]1OC(=O)c1ccc(Br)cc1.
What is the InChIKey of [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate?
The InChIKey is YZPPBZZKLKOWCM-JLCHBGMNSA-N. The full InChI is InChI=1S/C19H21BrO5/c1-19(12-4-3-5-17(22)24-2)15(21)10-11-16(19)25-18(23)13-6-8-14(20)9-7-13/h3,5-9,16H,4,10-12H2,1-2H3/b5-3+/t16-,19-/m0/s1.
What are the key properties of [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate?
[(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate has a molecular weight of 409.28 g/mol, XLogP of 3.85, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-[(E)-5-methoxy-5-oxopent-3-enyl]-2-methyl-3-oxocyclopentyl] 4-bromobenzoate is sourced from PubChem (CID 135010101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).