About [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane
[(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 135010175) has the molecular formula C18H30FNOSi
and a molecular weight of 323.53 g/mol. Its IUPAC name is [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane |
| PubChem CID | 135010175 |
| Molecular Formula | C18H30FNOSi |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](F)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H30FNOSi/c1-18(2,3)22(4,5)21-17-11-16(19)13-20(14-17)12-15-9-7-6-8-10-15/h6-10,16-17H,11-14H2,1-5H3/t16-,17-/m1/s1 |
| InChIKey | VYTIGQCPWPDVCE-IAGOWNOFSA-N |
| XLogP | 4.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane?
The IUPAC name of [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane (CID 135010175) is [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane.
What is the SMILES notation for [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane?
The canonical SMILES for [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane is CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](F)CN(Cc2ccccc2)C1.
What is the InChIKey of [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane?
The InChIKey is VYTIGQCPWPDVCE-IAGOWNOFSA-N. The full InChI is InChI=1S/C18H30FNOSi/c1-18(2,3)22(4,5)21-17-11-16(19)13-20(14-17)12-15-9-7-6-8-10-15/h6-10,16-17H,11-14H2,1-5H3/t16-,17-/m1/s1.
What are the key properties of [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane?
[(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane has a molecular weight of 323.53 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5R)-1-benzyl-5-fluoropiperidin-3-yl]oxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 135010175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).