C18H26O4 — CID 135010176
6-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-3-(2-hydroxypropyl)pyran-2-one (PubChem CID 135010176) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 6-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-3-(2-hydroxypropyl)pyran-2-one.
| Compound Name | 6-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-3-(2-hydroxypropyl)pyran-2-one |
|---|---|
| PubChem CID | 135010176 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 6-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-3-(2-hydroxypropyl)pyran-2-one |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc(O)c(CC(C)O)c(=O)o1 |
| InChI | InChI=1S/C18H26O4/c1-12(2)6-5-7-13(3)8-9-15-11-17(20)16(10-14(4)19)18(21)22-15/h6,8,11,14,19-20H,5,7,9-10H2,1-4H3/b13-8+ |
| InChIKey | WUZGWXAXWIUXIP-MDWZMJQESA-N |
| XLogP | 3.50 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|