C13H18O5 — CID 135010245
[(1R,3R,4S,8R,10R)-3-methyl-7-oxo-2,9-dioxatricyclo[6.2.1.13,10]dodecan-4-yl] acetate (PubChem CID 135010245) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is [(1R,3R,4S,8R,10R)-3-methyl-7-oxo-2,9-dioxatricyclo[6.2.1.13,10]dodecan-4-yl] acetate.
| Compound Name | [(1R,3R,4S,8R,10R)-3-methyl-7-oxo-2,9-dioxatricyclo[6.2.1.13,10]dodecan-4-yl] acetate |
|---|---|
| PubChem CID | 135010245 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [(1R,3R,4S,8R,10R)-3-methyl-7-oxo-2,9-dioxatricyclo[6.2.1.13,10]dodecan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC(=O)[C@H]2C[C@H]3O[C@]1(C)C[C@H]3O2 |
| InChI | InChI=1S/C13H18O5/c1-7(14)16-12-4-3-8(15)9-5-10-11(17-9)6-13(12,2)18-10/h9-12H,3-6H2,1-2H3/t9-,10-,11-,12+,13-/m1/s1 |
| InChIKey | OIMWBGLJEOYIPA-NJMOYASZSA-N |
| XLogP | 0.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |