C21H40O2Si — CID 135010386
(Z)-3-[(1S,2R,4S)-4-tert-butyl-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol (PubChem CID 135010386) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is (Z)-3-[(1S,2R,4S)-4-tert-butyl-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol.
| Compound Name | (Z)-3-[(1S,2R,4S)-4-tert-butyl-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol |
|---|---|
| PubChem CID | 135010386 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | (Z)-3-[(1S,2R,4S)-4-tert-butyl-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol |
| SMILES | C=C[C@H]1C[C@@H](C(C)(C)C)CC[C@@H]1/C=C(/CO)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H40O2Si/c1-8-17-14-19(21(5,6)7)13-12-18(17)15-20(16-22)23-24(9-2,10-3)11-4/h8,15,17-19,22H,1,9-14,16H2,2-7H3/b20-15-/t17-,18+,19-/m0/s1 |
| InChIKey | WUSTWNMVTJAAGS-VSEDDNRTSA-N |
| XLogP | 6.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|