About (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol
(E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol (PubChem CID 135010389) has the molecular formula C17H32O2Si
and a molecular weight of 296.53 g/mol. Its IUPAC name is (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol |
| PubChem CID | 135010389 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol |
| SMILES | C=C[C@H]1CCCC[C@@H]1/C=C(\CO)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C17H32O2Si/c1-5-15-11-9-10-12-16(15)13-17(14-18)19-20(6-2,7-3)8-4/h5,13,15-16,18H,1,6-12,14H2,2-4H3/b17-13+/t15-,16+/m0/s1 |
| InChIKey | FWPSSJSISRNBOC-YUFKHZPFSA-N |
| XLogP | 4.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol?
The IUPAC name of (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol (CID 135010389) is (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol.
What is the SMILES notation for (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol?
The canonical SMILES for (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol is C=C[C@H]1CCCC[C@@H]1/C=C(\CO)O[Si](CC)(CC)CC.
What is the InChIKey of (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol?
The InChIKey is FWPSSJSISRNBOC-YUFKHZPFSA-N. The full InChI is InChI=1S/C17H32O2Si/c1-5-15-11-9-10-12-16(15)13-17(14-18)19-20(6-2,7-3)8-4/h5,13,15-16,18H,1,6-12,14H2,2-4H3/b17-13+/t15-,16+/m0/s1.
What are the key properties of (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol?
(E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol has a molecular weight of 296.53 g/mol, XLogP of 4.88, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[(1S,2R)-2-ethenylcyclohexyl]-2-triethylsilyloxyprop-2-en-1-ol is sourced from PubChem (CID 135010389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).