C38H40F2O7 — CID 135010463
ethyl 2,2-difluoro-2-[(2S,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate (PubChem CID 135010463) has the molecular formula C38H40F2O7 and a molecular weight of 646.73 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-[(2S,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate.
| Compound Name | ethyl 2,2-difluoro-2-[(2S,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 135010463 |
| Molecular Formula | C38H40F2O7 |
| Molecular Weight | 646.73 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | ethyl 2,2-difluoro-2-[(2S,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate |
| SMILES | CCOC(=O)C(F)(F)[C@H]1O[C@@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H40F2O7/c1-2-43-37(41)38(39,40)36-35(46-26-31-21-13-6-14-22-31)34(45-25-30-19-11-5-12-20-30)33(44-24-29-17-9-4-10-18-29)32(47-36)27-42-23-28-15-7-3-8-16-28/h3-22,32-36H,2,23-27H2,1H3/t32-,33+,34-,35-,36-/m0/s1 |
| InChIKey | POCVIVHMXKUPLX-YNOSRJHOSA-N |
| XLogP | 6.93 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.73 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |