About [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate
[1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate (PubChem CID 135010472) has the molecular formula C22H18BrNO3
and a molecular weight of 424.29 g/mol. Its IUPAC name is [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate.
Molecular Properties
| Compound Name | [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate |
| PubChem CID | 135010472 |
| Molecular Formula | C22H18BrNO3 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate |
| SMILES | CC(OC(=O)N(c1ccccc1)c1ccccc1)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H18BrNO3/c1-16(21(25)17-12-14-18(23)15-13-17)27-22(26)24(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-16H,1H3 |
| InChIKey | KHDXLFACRCNFFE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate?
The IUPAC name of [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate (CID 135010472) is [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate.
What is the SMILES notation for [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate?
The canonical SMILES for [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate is CC(OC(=O)N(c1ccccc1)c1ccccc1)C(=O)c1ccc(Br)cc1.
What is the InChIKey of [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate?
The InChIKey is KHDXLFACRCNFFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18BrNO3/c1-16(21(25)17-12-14-18(23)15-13-17)27-22(26)24(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-16H,1H3.
What are the key properties of [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate?
[1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate has a molecular weight of 424.29 g/mol, XLogP of 6.00, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-bromophenyl)-1-oxopropan-2-yl] N,N-diphenylcarbamate is sourced from PubChem (CID 135010472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).