About 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine
2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine (PubChem CID 135010535) has the molecular formula C21H24NO3P
and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine.
Molecular Properties
| Compound Name | 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine |
| PubChem CID | 135010535 |
| Molecular Formula | C21H24NO3P |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine |
| SMILES | C=CC1=CCN(Cc2ccccc2)C(P(=O)(OC)OC)c2ccccc21 |
| InChI | InChI=1S/C21H24NO3P/c1-4-18-14-15-22(16-17-10-6-5-7-11-17)21(26(23,24-2)25-3)20-13-9-8-12-19(18)20/h4-14,21H,1,15-16H2,2-3H3 |
| InChIKey | CASCRZIBQWIESE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine?
The IUPAC name of 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine (CID 135010535) is 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine.
What is the SMILES notation for 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine?
The canonical SMILES for 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine is C=CC1=CCN(Cc2ccccc2)C(P(=O)(OC)OC)c2ccccc21.
What is the InChIKey of 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine?
The InChIKey is CASCRZIBQWIESE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24NO3P/c1-4-18-14-15-22(16-17-10-6-5-7-11-17)21(26(23,24-2)25-3)20-13-9-8-12-19(18)20/h4-14,21H,1,15-16H2,2-3H3.
What are the key properties of 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine?
2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine has a molecular weight of 369.40 g/mol, XLogP of 5.26, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1-dimethoxyphosphoryl-5-ethenyl-1,3-dihydro-2-benzazepine is sourced from PubChem (CID 135010535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).