C16H22O4S — CID 135010634
methyl (Z)-5,7-dimethoxy-3-phenylsulfanylhept-2-enoate (PubChem CID 135010634) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is methyl (Z)-5,7-dimethoxy-3-phenylsulfanylhept-2-enoate.
| Compound Name | methyl (Z)-5,7-dimethoxy-3-phenylsulfanylhept-2-enoate |
|---|---|
| PubChem CID | 135010634 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | methyl (Z)-5,7-dimethoxy-3-phenylsulfanylhept-2-enoate |
| SMILES | COCCC(C/C(=C/C(=O)OC)Sc1ccccc1)OC |
| InChI | InChI=1S/C16H22O4S/c1-18-10-9-13(19-2)11-15(12-16(17)20-3)21-14-7-5-4-6-8-14/h4-8,12-13H,9-11H2,1-3H3/b15-12- |
| InChIKey | MMIOFCZWMJJKAN-QINSGFPZSA-N |
| XLogP | 3.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|