C22H34F2O4 — CID 135010775
diethyl 4-(1,1-difluorodecyl)cyclohexa-1,4-diene-1,2-dicarboxylate (PubChem CID 135010775) has the molecular formula C22H34F2O4 and a molecular weight of 400.51 g/mol. Its IUPAC name is diethyl 4-(1,1-difluorodecyl)cyclohexa-1,4-diene-1,2-dicarboxylate.
| Compound Name | diethyl 4-(1,1-difluorodecyl)cyclohexa-1,4-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 135010775 |
| Molecular Formula | C22H34F2O4 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | diethyl 4-(1,1-difluorodecyl)cyclohexa-1,4-diene-1,2-dicarboxylate |
| SMILES | CCCCCCCCCC(F)(F)C1=CCC(C(=O)OCC)=C(C(=O)OCC)C1 |
| InChI | InChI=1S/C22H34F2O4/c1-4-7-8-9-10-11-12-15-22(23,24)17-13-14-18(20(25)27-5-2)19(16-17)21(26)28-6-3/h13H,4-12,14-16H2,1-3H3 |
| InChIKey | RXQZBUOPQRLXNL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|